5-formylthiophene-2-carbonitrile
Catalog No: FT-0719426
CAS No: 21512-16-3
- Chemical Name: 5-formylthiophene-2-carbonitrile
- Molecular Formula: C6H3NOS
- Molecular Weight: 137.16
- InChI Key: PZIFYWVUYHMYOA-UHFFFAOYSA-N
- InChI: InChI=1S/C6H3NOS/c7-3-5-1-2-6(4-8)9-5/h1-2,4H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 5-Formylthiophene-2-carbonitrile |
|---|---|
| Bolling_Point: | 232.1±20.0 °C at 760 mmHg |
| MF: | C6H3NOS |
| Symbol: | GHS07 |
| Melting_Point: | N/A |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 21512-16-3 |
| FW: | 137.159 |
| Flash_Point: | 94.2±21.8 °C |
| MF: | C6H3NOS |
|---|---|
| Refractive_Index: | 1.580 |
| Flash_Point: | 94.2±21.8 °C |
| PSA: | 69.10000 |
| Bolling_Point: | 232.1±20.0 °C at 760 mmHg |
| Density: | 1.3±0.1 g/cm3 |
| Exact_Mass: | 136.993530 |
| FW: | 137.159 |
| LogP: | 0.49 |
| Vapor_Pressure: | 0.1±0.5 mmHg at 25°C |
| HS_Code: | 2934999090 |
|---|---|
| Safety_Statements: | H302-H319 |
| Warning_Statement: | P305 + P351 + P338 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)